C26H21ClN2O3S2 — CID 23100906
2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(2-chlorophenyl)-2-phenylacetamide (PubChem CID 23100906) has the molecular formula C26H21ClN2O3S2 and a molecular weight of 509.05 g/mol. Its IUPAC name is 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(2-chlorophenyl)-2-phenylacetamide.
| Compound Name | 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(2-chlorophenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 23100906 |
| Molecular Formula | C26H21ClN2O3S2 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(2-chlorophenyl)-2-phenylacetamide |
| SMILES | O=C(Nc1ccccc1Cl)C(Sc1ccc(NS(=O)(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H21ClN2O3S2/c27-23-13-7-8-14-24(23)28-26(30)25(19-9-3-1-4-10-19)33-21-17-15-20(16-18-21)29-34(31,32)22-11-5-2-6-12-22/h1-18,25,29H,(H,28,30) |
| InChIKey | ONZDJPYKJWHTAL-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |