C34H24N2O5S2 — CID 21171584
2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(9,10-dioxoanthracen-1-yl)-2-phenylacetamide (PubChem CID 21171584) has the molecular formula C34H24N2O5S2 and a molecular weight of 604.71 g/mol. Its IUPAC name is 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(9,10-dioxoanthracen-1-yl)-2-phenylacetamide.
| Compound Name | 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(9,10-dioxoanthracen-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 21171584 |
| Molecular Formula | C34H24N2O5S2 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.11 |
| IUPAC Name | 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(9,10-dioxoanthracen-1-yl)-2-phenylacetamide |
| SMILES | O=C1c2ccccc2C(=O)c2c(NC(=O)C(Sc3ccc(NS(=O)(=O)c4ccccc4)cc3)c3ccccc3)cccc21 |
| InChI | InChI=1S/C34H24N2O5S2/c37-31-26-14-7-8-15-27(26)32(38)30-28(31)16-9-17-29(30)35-34(39)33(22-10-3-1-4-11-22)42-24-20-18-23(19-21-24)36-43(40,41)25-12-5-2-6-13-25/h1-21,33,36H,(H,35,39) |
| InChIKey | JLIOYPLUIMIUOF-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|