C30H24N2O5S2 — CID 21169945
N-(9,10-dioxoanthracen-1-yl)-2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanylpropanamide (PubChem CID 21169945) has the molecular formula C30H24N2O5S2 and a molecular weight of 556.67 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanylpropanamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 21169945 |
| Molecular Formula | C30H24N2O5S2 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(SC(C)C(=O)Nc3cccc4c3C(=O)c3ccccc3C4=O)cc2)cc1 |
| InChI | InChI=1S/C30H24N2O5S2/c1-18-10-16-22(17-11-18)39(36,37)32-20-12-14-21(15-13-20)38-19(2)30(35)31-26-9-5-8-25-27(26)29(34)24-7-4-3-6-23(24)28(25)33/h3-17,19,32H,1-2H3,(H,31,35) |
| InChIKey | BTPMHTUIMLBRQV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|