C30H20Cl2N2O4S — CID 21170731
2,4-dichloro-N-[4-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]benzamide (PubChem CID 21170731) has the molecular formula C30H20Cl2N2O4S and a molecular weight of 575.47 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 21170731 |
| Molecular Formula | C30H20Cl2N2O4S |
| Molecular Weight | 575.47 g/mol |
| Exact Mass | 574.05 |
| IUPAC Name | 2,4-dichloro-N-[4-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1)C(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H20Cl2N2O4S/c1-16(39-19-12-10-18(11-13-19)33-30(38)22-14-9-17(31)15-24(22)32)29(37)34-25-8-4-7-23-26(25)28(36)21-6-3-2-5-20(21)27(23)35/h2-16H,1H3,(H,33,38)(H,34,37) |
| InChIKey | UJWAZVOLFMTMOR-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.47 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|