C30H23N3O3S2 — CID 19712664
N-(9,10-dioxoanthracen-1-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide (PubChem CID 19712664) has the molecular formula C30H23N3O3S2 and a molecular weight of 537.67 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 19712664 |
| Molecular Formula | C30H23N3O3S2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide |
| SMILES | CC(Sc1ccc(NC(=S)Nc2ccccc2)cc1)C(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H23N3O3S2/c1-18(38-21-16-14-20(15-17-21)32-30(37)31-19-8-3-2-4-9-19)29(36)33-25-13-7-12-24-26(25)28(35)23-11-6-5-10-22(23)27(24)34/h2-18H,1H3,(H,33,36)(H2,31,32,37) |
| InChIKey | YFJNCAJLMUWGQA-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|