C28H20N2O5S — CID 18913147
N-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]furan-2-carboxamide (PubChem CID 18913147) has the molecular formula C28H20N2O5S and a molecular weight of 496.54 g/mol. Its IUPAC name is N-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 18913147 |
| Molecular Formula | C28H20N2O5S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | N-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]furan-2-carboxamide |
| SMILES | CC(Sc1cccc(NC(=O)c2ccco2)c1)C(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H20N2O5S/c1-16(36-18-8-4-7-17(15-18)29-28(34)23-13-6-14-35-23)27(33)30-22-12-5-11-21-24(22)26(32)20-10-3-2-9-19(20)25(21)31/h2-16H,1H3,(H,29,34)(H,30,33) |
| InChIKey | ZPPLYGWVTGHUMK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|