C40H31N3O6S — CID 19319895
N-[(E)-3-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19319895) has the molecular formula C40H31N3O6S and a molecular weight of 681.77 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19319895 |
| Molecular Formula | C40H31N3O6S |
| Molecular Weight | 681.77 g/mol |
| Exact Mass | 681.19 |
| IUPAC Name | N-[(E)-3-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C)C(=O)Nc3cccc4c3C(=O)c3ccccc3C4=O)c2)cc1 |
| InChI | InChI=1S/C40H31N3O6S/c1-24(38(46)42-33-17-9-16-32-35(33)37(45)31-15-7-6-14-30(31)36(32)44)50-29-13-8-12-27(23-29)41-40(48)34(22-25-18-20-28(49-2)21-19-25)43-39(47)26-10-4-3-5-11-26/h3-24H,1-2H3,(H,41,48)(H,42,46)(H,43,47)/b34-22+ |
| InChIKey | CSYVLDYBVDCOPA-PPOKSSTKSA-N |
| XLogP | 7.00 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.77 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|