C41H33N3O6S — CID 19320183
N-[(E)-3-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19320183) has the molecular formula C41H33N3O6S and a molecular weight of 695.80 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19320183 |
| Molecular Formula | C41H33N3O6S |
| Molecular Weight | 695.80 g/mol |
| Exact Mass | 695.21 |
| IUPAC Name | N-[(E)-3-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C)C(=O)Nc3cccc4c3C(=O)c3ccccc3C4=O)c2)cc1 |
| InChI | InChI=1S/C41H33N3O6S/c1-3-50-29-21-19-26(20-22-29)23-35(44-40(48)27-11-5-4-6-12-27)41(49)42-28-13-9-14-30(24-28)51-25(2)39(47)43-34-18-10-17-33-36(34)38(46)32-16-8-7-15-31(32)37(33)45/h4-25H,3H2,1-2H3,(H,42,49)(H,43,47)(H,44,48)/b35-23+ |
| InChIKey | SIMOFRTXEOIZJR-QCFMCPCVSA-N |
| XLogP | 7.39 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.80 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|