C40H31N3O5S — CID 19715170
N-[(Z)-3-[4-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19715170) has the molecular formula C40H31N3O5S and a molecular weight of 665.77 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19715170 |
| Molecular Formula | C40H31N3O5S |
| Molecular Weight | 665.77 g/mol |
| Exact Mass | 665.20 |
| IUPAC Name | N-[(Z)-3-[4-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C)C(=O)Nc3cccc4c3C(=O)c3ccccc3C4=O)cc2)cc1 |
| InChI | InChI=1S/C40H31N3O5S/c1-24-15-17-26(18-16-24)23-34(43-39(47)27-9-4-3-5-10-27)40(48)41-28-19-21-29(22-20-28)49-25(2)38(46)42-33-14-8-13-32-35(33)37(45)31-12-7-6-11-30(31)36(32)44/h3-23,25H,1-2H3,(H,41,48)(H,42,46)(H,43,47)/b34-23- |
| InChIKey | RQYSUGHPYVQJLL-XSVYLIDLSA-N |
| XLogP | 7.30 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.77 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|