C46H35N3O6S — CID 19715341
N-[(Z)-3-[4-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19715341) has the molecular formula C46H35N3O6S and a molecular weight of 757.87 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19715341 |
| Molecular Formula | C46H35N3O6S |
| Molecular Weight | 757.87 g/mol |
| Exact Mass | 757.22 |
| IUPAC Name | N-[(Z)-3-[4-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2ccc(OCc3ccccc3)cc2)NC(=O)c2ccccc2)cc1)C(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C46H35N3O6S/c1-29(44(52)48-39-18-10-17-38-41(39)43(51)37-16-9-8-15-36(37)42(38)50)56-35-25-21-33(22-26-35)47-46(54)40(49-45(53)32-13-6-3-7-14-32)27-30-19-23-34(24-20-30)55-28-31-11-4-2-5-12-31/h2-27,29H,28H2,1H3,(H,47,54)(H,48,52)(H,49,53)/b40-27- |
| InChIKey | XBUKAUWQGXRWPW-DPVRLLIJSA-N |
| XLogP | 8.57 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.87 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|