C20H14N2O4S — CID 19318751
N-[3-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]phenyl]furan-2-carboxamide (PubChem CID 19318751) has the molecular formula C20H14N2O4S and a molecular weight of 378.41 g/mol. Its IUPAC name is N-[3-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19318751 |
| Molecular Formula | C20H14N2O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-[3-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(SCN2C(=O)c3ccccc3C2=O)c1)c1ccco1 |
| InChI | InChI=1S/C20H14N2O4S/c23-18(17-9-4-10-26-17)21-13-5-3-6-14(11-13)27-12-22-19(24)15-7-1-2-8-16(15)20(22)25/h1-11H,12H2,(H,21,23) |
| InChIKey | SWYXAZJREVIOQA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|