C19H16N2O3S — CID 19318740
N-[3-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]phenyl]cyclopropanecarboxamide (PubChem CID 19318740) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is N-[3-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 19318740 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-[3-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1cccc(SCN2C(=O)c3ccccc3C2=O)c1)C1CC1 |
| InChI | InChI=1S/C19H16N2O3S/c22-17(12-8-9-12)20-13-4-3-5-14(10-13)25-11-21-18(23)15-6-1-2-7-16(15)19(21)24/h1-7,10,12H,8-9,11H2,(H,20,22) |
| InChIKey | DWNUYJGBCKYIRG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|