C24H21NO2S — CID 19299425
N-[3-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylphenyl]cyclopropanecarboxamide (PubChem CID 19299425) has the molecular formula C24H21NO2S and a molecular weight of 387.50 g/mol. Its IUPAC name is N-[3-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 19299425 |
| Molecular Formula | C24H21NO2S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[3-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylphenyl]cyclopropanecarboxamide |
| SMILES | O=C(CSc1cccc(NC(=O)C2CC2)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21NO2S/c26-23(19-11-9-18(10-12-19)17-5-2-1-3-6-17)16-28-22-8-4-7-21(15-22)25-24(27)20-13-14-20/h1-12,15,20H,13-14,16H2,(H,25,27) |
| InChIKey | VJYWMQKNMCJZKP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |