C21H17FN2OS2 — CID 19300075
1-[3-[2-(4-fluorophenyl)-2-oxoethyl]sulfanylphenyl]-3-phenylthiourea (PubChem CID 19300075) has the molecular formula C21H17FN2OS2 and a molecular weight of 396.51 g/mol. Its IUPAC name is 1-[3-[2-(4-fluorophenyl)-2-oxoethyl]sulfanylphenyl]-3-phenylthiourea.
| Compound Name | 1-[3-[2-(4-fluorophenyl)-2-oxoethyl]sulfanylphenyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 19300075 |
| Molecular Formula | C21H17FN2OS2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 1-[3-[2-(4-fluorophenyl)-2-oxoethyl]sulfanylphenyl]-3-phenylthiourea |
| SMILES | O=C(CSc1cccc(NC(=S)Nc2ccccc2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H17FN2OS2/c22-16-11-9-15(10-12-16)20(25)14-27-19-8-4-7-18(13-19)24-21(26)23-17-5-2-1-3-6-17/h1-13H,14H2,(H2,23,24,26) |
| InChIKey | INNSHTGFMWDXBP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|