C26H19N3O5S — CID 83278851
N-[3-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide (PubChem CID 83278851) has the molecular formula C26H19N3O5S and a molecular weight of 485.52 g/mol. Its IUPAC name is N-[3-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 83278851 |
| Molecular Formula | C26H19N3O5S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | N-[3-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(SC2=C(Nc3ccccc3)C(=O)N(Cc3ccco3)C2=O)c1)c1ccco1 |
| InChI | InChI=1S/C26H19N3O5S/c30-24(21-12-6-14-34-21)28-18-9-4-11-20(15-18)35-23-22(27-17-7-2-1-3-8-17)25(31)29(26(23)32)16-19-10-5-13-33-19/h1-15,27H,16H2,(H,28,30) |
| InChIKey | LNPBLDYVGQOUGK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|