C30H24ClN3O6S — CID 91635623
2-chloro-N-[3-[4-(2,4-dimethoxyanilino)-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 91635623) has the molecular formula C30H24ClN3O6S and a molecular weight of 590.06 g/mol. Its IUPAC name is 2-chloro-N-[3-[4-(2,4-dimethoxyanilino)-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[4-(2,4-dimethoxyanilino)-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 91635623 |
| Molecular Formula | C30H24ClN3O6S |
| Molecular Weight | 590.06 g/mol |
| Exact Mass | 589.11 |
| IUPAC Name | 2-chloro-N-[3-[4-(2,4-dimethoxyanilino)-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | COc1ccc(NC2=C(Sc3cccc(NC(=O)c4ccccc4Cl)c3)C(=O)N(Cc3ccco3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C30H24ClN3O6S/c1-38-19-12-13-24(25(16-19)39-2)33-26-27(30(37)34(29(26)36)17-20-8-6-14-40-20)41-21-9-5-7-18(15-21)32-28(35)22-10-3-4-11-23(22)31/h3-16,33H,17H2,1-2H3,(H,32,35) |
| InChIKey | CXBKVHNCRGOATN-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.06 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|