C29H22FN3O5S — CID 83275251
4-fluoro-N-[3-[1-(furan-2-ylmethyl)-4-(4-methoxyanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83275251) has the molecular formula C29H22FN3O5S and a molecular weight of 543.58 g/mol. Its IUPAC name is 4-fluoro-N-[3-[1-(furan-2-ylmethyl)-4-(4-methoxyanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 4-fluoro-N-[3-[1-(furan-2-ylmethyl)-4-(4-methoxyanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83275251 |
| Molecular Formula | C29H22FN3O5S |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | 4-fluoro-N-[3-[1-(furan-2-ylmethyl)-4-(4-methoxyanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | COc1ccc(NC2=C(Sc3cccc(NC(=O)c4ccc(F)cc4)c3)C(=O)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C29H22FN3O5S/c1-37-22-13-11-20(12-14-22)31-25-26(29(36)33(28(25)35)17-23-5-3-15-38-23)39-24-6-2-4-21(16-24)32-27(34)18-7-9-19(30)10-8-18/h2-16,31H,17H2,1H3,(H,32,34) |
| InChIKey | PUEVXHPTBLKRFX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|