C31H21F4N3O4S — CID 71957252
4-fluoro-N-[3-[4-(4-methoxyanilino)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 71957252) has the molecular formula C31H21F4N3O4S and a molecular weight of 607.59 g/mol. Its IUPAC name is 4-fluoro-N-[3-[4-(4-methoxyanilino)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 4-fluoro-N-[3-[4-(4-methoxyanilino)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 71957252 |
| Molecular Formula | C31H21F4N3O4S |
| Molecular Weight | 607.59 g/mol |
| Exact Mass | 607.12 |
| IUPAC Name | 4-fluoro-N-[3-[4-(4-methoxyanilino)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | COc1ccc(NC2=C(Sc3cccc(NC(=O)c4ccc(F)cc4)c3)C(=O)N(c3ccc(C(F)(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C31H21F4N3O4S/c1-42-24-15-11-21(12-16-24)36-26-27(30(41)38(29(26)40)23-13-7-19(8-14-23)31(33,34)35)43-25-4-2-3-22(17-25)37-28(39)18-5-9-20(32)10-6-18/h2-17,36H,1H3,(H,37,39) |
| InChIKey | RUNQEHSBJSZTMQ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.59 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|