C31H22F3N3O3S — CID 71959269
N-[3-[4-anilino-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-(trifluoromethyl)benzamide (PubChem CID 71959269) has the molecular formula C31H22F3N3O3S and a molecular weight of 573.60 g/mol. Its IUPAC name is N-[3-[4-anilino-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[4-anilino-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 71959269 |
| Molecular Formula | C31H22F3N3O3S |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | N-[3-[4-anilino-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(N2C(=O)C(Nc3ccccc3)=C(Sc3cccc(NC(=O)c4ccc(C(F)(F)F)cc4)c3)C2=O)cc1 |
| InChI | InChI=1S/C31H22F3N3O3S/c1-19-10-16-24(17-11-19)37-29(39)26(35-22-6-3-2-4-7-22)27(30(37)40)41-25-9-5-8-23(18-25)36-28(38)20-12-14-21(15-13-20)31(32,33)34/h2-18,35H,1H3,(H,36,38) |
| InChIKey | VRHHSFKBUZHSAI-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|