C30H23N3O4S — CID 83275014
N-[3-(4-anilino-2,5-dioxo-1-phenylpyrrol-3-yl)sulfanylphenyl]-4-methoxybenzamide (PubChem CID 83275014) has the molecular formula C30H23N3O4S and a molecular weight of 521.60 g/mol. Its IUPAC name is N-[3-(4-anilino-2,5-dioxo-1-phenylpyrrol-3-yl)sulfanylphenyl]-4-methoxybenzamide.
| Compound Name | N-[3-(4-anilino-2,5-dioxo-1-phenylpyrrol-3-yl)sulfanylphenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 83275014 |
| Molecular Formula | C30H23N3O4S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | N-[3-(4-anilino-2,5-dioxo-1-phenylpyrrol-3-yl)sulfanylphenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(SC3=C(Nc4ccccc4)C(=O)N(c4ccccc4)C3=O)c2)cc1 |
| InChI | InChI=1S/C30H23N3O4S/c1-37-24-17-15-20(16-18-24)28(34)32-22-11-8-14-25(19-22)38-27-26(31-21-9-4-2-5-10-21)29(35)33(30(27)36)23-12-6-3-7-13-23/h2-19,31H,1H3,(H,32,34) |
| InChIKey | VFIORVAAECKNNR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|