C32H27N3O4S — CID 83274654
N-[3-[4-anilino-1-(3,4-dimethylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-3-methoxybenzamide (PubChem CID 83274654) has the molecular formula C32H27N3O4S and a molecular weight of 549.65 g/mol. Its IUPAC name is N-[3-[4-anilino-1-(3,4-dimethylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-3-methoxybenzamide.
| Compound Name | N-[3-[4-anilino-1-(3,4-dimethylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 83274654 |
| Molecular Formula | C32H27N3O4S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | N-[3-[4-anilino-1-(3,4-dimethylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2cccc(SC3=C(Nc4ccccc4)C(=O)N(c4ccc(C)c(C)c4)C3=O)c2)c1 |
| InChI | InChI=1S/C32H27N3O4S/c1-20-15-16-25(17-21(20)2)35-31(37)28(33-23-10-5-4-6-11-23)29(32(35)38)40-27-14-8-12-24(19-27)34-30(36)22-9-7-13-26(18-22)39-3/h4-19,33H,1-3H3,(H,34,36) |
| InChIKey | VLZHGLVMQQYCFX-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|