C33H29N3O6S — CID 83277789
N-[4-[1-(2,4-dimethoxyphenyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-3-methoxybenzamide (PubChem CID 83277789) has the molecular formula C33H29N3O6S and a molecular weight of 595.68 g/mol. Its IUPAC name is N-[4-[1-(2,4-dimethoxyphenyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-3-methoxybenzamide.
| Compound Name | N-[4-[1-(2,4-dimethoxyphenyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 83277789 |
| Molecular Formula | C33H29N3O6S |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | N-[4-[1-(2,4-dimethoxyphenyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(SC3=C(Nc4ccc(C)cc4)C(=O)N(c4ccc(OC)cc4OC)C3=O)cc2)c1 |
| InChI | InChI=1S/C33H29N3O6S/c1-20-8-10-22(11-9-20)34-29-30(33(39)36(32(29)38)27-17-14-25(41-3)19-28(27)42-4)43-26-15-12-23(13-16-26)35-31(37)21-6-5-7-24(18-21)40-2/h5-19,34H,1-4H3,(H,35,37) |
| InChIKey | XKDGGTVCOZJPCM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|