C32H26N4O7S — CID 71957007
N-[3-[4-(4-methoxyanilino)-1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 71957007) has the molecular formula C32H26N4O7S and a molecular weight of 610.65 g/mol. Its IUPAC name is N-[3-[4-(4-methoxyanilino)-1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[4-(4-methoxyanilino)-1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 71957007 |
| Molecular Formula | C32H26N4O7S |
| Molecular Weight | 610.65 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | N-[3-[4-(4-methoxyanilino)-1-(2-methoxy-5-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | COc1ccc(NC2=C(Sc3cccc(NC(=O)c4ccc([N+](=O)[O-])cc4)c3)C(=O)N(c3cc(C)ccc3OC)C2=O)cc1 |
| InChI | InChI=1S/C32H26N4O7S/c1-19-7-16-27(43-3)26(17-19)35-31(38)28(33-21-10-14-24(42-2)15-11-21)29(32(35)39)44-25-6-4-5-22(18-25)34-30(37)20-8-12-23(13-9-20)36(40)41/h4-18,33H,1-3H3,(H,34,37) |
| InChIKey | NBSVGCWSUMQLLP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|