C30H21FN4O5S — CID 83277724
N-[3-[1-(4-fluorophenyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 83277724) has the molecular formula C30H21FN4O5S and a molecular weight of 568.59 g/mol. Its IUPAC name is N-[3-[1-(4-fluorophenyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[1-(4-fluorophenyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 83277724 |
| Molecular Formula | C30H21FN4O5S |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | N-[3-[1-(4-fluorophenyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | Cc1ccc(NC2=C(Sc3cccc(NC(=O)c4ccc([N+](=O)[O-])cc4)c3)C(=O)N(c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C30H21FN4O5S/c1-18-5-11-21(12-6-18)32-26-27(30(38)34(29(26)37)23-15-9-20(31)10-16-23)41-25-4-2-3-22(17-25)33-28(36)19-7-13-24(14-8-19)35(39)40/h2-17,32H,1H3,(H,33,36) |
| InChIKey | KQGCTUNIXLXNPJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|