C31H24ClN3O3S — CID 83277746
2-chloro-N-[3-[4-(4-methylanilino)-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83277746) has the molecular formula C31H24ClN3O3S and a molecular weight of 554.07 g/mol. Its IUPAC name is 2-chloro-N-[3-[4-(4-methylanilino)-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[4-(4-methylanilino)-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83277746 |
| Molecular Formula | C31H24ClN3O3S |
| Molecular Weight | 554.07 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | 2-chloro-N-[3-[4-(4-methylanilino)-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | Cc1ccc(NC2=C(Sc3cccc(NC(=O)c4ccccc4Cl)c3)C(=O)N(c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C31H24ClN3O3S/c1-19-10-14-21(15-11-19)33-27-28(31(38)35(30(27)37)23-16-12-20(2)13-17-23)39-24-7-5-6-22(18-24)34-29(36)25-8-3-4-9-26(25)32/h3-18,33H,1-2H3,(H,34,36) |
| InChIKey | WXXHUJSLYAXOJS-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.07 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|