C27H24ClN3O3S — CID 83277873
2-chloro-N-[4-[4-(4-methylanilino)-2,5-dioxo-1-propan-2-ylpyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83277873) has the molecular formula C27H24ClN3O3S and a molecular weight of 506.03 g/mol. Its IUPAC name is 2-chloro-N-[4-[4-(4-methylanilino)-2,5-dioxo-1-propan-2-ylpyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 2-chloro-N-[4-[4-(4-methylanilino)-2,5-dioxo-1-propan-2-ylpyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83277873 |
| Molecular Formula | C27H24ClN3O3S |
| Molecular Weight | 506.03 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | 2-chloro-N-[4-[4-(4-methylanilino)-2,5-dioxo-1-propan-2-ylpyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | Cc1ccc(NC2=C(Sc3ccc(NC(=O)c4ccccc4Cl)cc3)C(=O)N(C(C)C)C2=O)cc1 |
| InChI | InChI=1S/C27H24ClN3O3S/c1-16(2)31-26(33)23(29-18-10-8-17(3)9-11-18)24(27(31)34)35-20-14-12-19(13-15-20)30-25(32)21-6-4-5-7-22(21)28/h4-16,29H,1-3H3,(H,30,32) |
| InChIKey | XUUSHYKFZGGQEU-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.03 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|