C26H22BrN3O3S — CID 83272877
N-[4-[4-(4-bromoanilino)-2,5-dioxo-1-propan-2-ylpyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83272877) has the molecular formula C26H22BrN3O3S and a molecular weight of 536.45 g/mol. Its IUPAC name is N-[4-[4-(4-bromoanilino)-2,5-dioxo-1-propan-2-ylpyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | N-[4-[4-(4-bromoanilino)-2,5-dioxo-1-propan-2-ylpyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83272877 |
| Molecular Formula | C26H22BrN3O3S |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | N-[4-[4-(4-bromoanilino)-2,5-dioxo-1-propan-2-ylpyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | CC(C)N1C(=O)C(Nc2ccc(Br)cc2)=C(Sc2ccc(NC(=O)c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C26H22BrN3O3S/c1-16(2)30-25(32)22(28-19-10-8-18(27)9-11-19)23(26(30)33)34-21-14-12-20(13-15-21)29-24(31)17-6-4-3-5-7-17/h3-16,28H,1-2H3,(H,29,31) |
| InChIKey | ISJIUCWGPUJTRF-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|