C28H27N3O3S — CID 83277866
N-[4-[4-(4-methylanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83277866) has the molecular formula C28H27N3O3S and a molecular weight of 485.61 g/mol. Its IUPAC name is N-[4-[4-(4-methylanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | N-[4-[4-(4-methylanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83277866 |
| Molecular Formula | C28H27N3O3S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | N-[4-[4-(4-methylanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | Cc1ccc(NC2=C(Sc3ccc(NC(=O)c4ccccc4)cc3)C(=O)N(CC(C)C)C2=O)cc1 |
| InChI | InChI=1S/C28H27N3O3S/c1-18(2)17-31-27(33)24(29-21-11-9-19(3)10-12-21)25(28(31)34)35-23-15-13-22(14-16-23)30-26(32)20-7-5-4-6-8-20/h4-16,18,29H,17H2,1-3H3,(H,30,32) |
| InChIKey | JAFRAARHELXTPU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|