C28H26FN3O4S — CID 83275215
4-fluoro-N-[4-[4-(4-methoxyanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83275215) has the molecular formula C28H26FN3O4S and a molecular weight of 519.60 g/mol. Its IUPAC name is 4-fluoro-N-[4-[4-(4-methoxyanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 4-fluoro-N-[4-[4-(4-methoxyanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83275215 |
| Molecular Formula | C28H26FN3O4S |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 4-fluoro-N-[4-[4-(4-methoxyanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | COc1ccc(NC2=C(Sc3ccc(NC(=O)c4ccc(F)cc4)cc3)C(=O)N(CC(C)C)C2=O)cc1 |
| InChI | InChI=1S/C28H26FN3O4S/c1-17(2)16-32-27(34)24(30-20-8-12-22(36-3)13-9-20)25(28(32)35)37-23-14-10-21(11-15-23)31-26(33)18-4-6-19(29)7-5-18/h4-15,17,30H,16H2,1-3H3,(H,31,33) |
| InChIKey | AAXSTOSPHVANHN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|