C27H23BrFN3O3S — CID 83272770
N-[3-[4-(4-bromoanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-fluorobenzamide (PubChem CID 83272770) has the molecular formula C27H23BrFN3O3S and a molecular weight of 568.47 g/mol. Its IUPAC name is N-[3-[4-(4-bromoanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-fluorobenzamide.
| Compound Name | N-[3-[4-(4-bromoanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 83272770 |
| Molecular Formula | C27H23BrFN3O3S |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 567.06 |
| IUPAC Name | N-[3-[4-(4-bromoanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-fluorobenzamide |
| SMILES | CC(C)CN1C(=O)C(Nc2ccc(Br)cc2)=C(Sc2cccc(NC(=O)c3ccc(F)cc3)c2)C1=O |
| InChI | InChI=1S/C27H23BrFN3O3S/c1-16(2)15-32-26(34)23(30-20-12-8-18(28)9-13-20)24(27(32)35)36-22-5-3-4-21(14-22)31-25(33)17-6-10-19(29)11-7-17/h3-14,16,30H,15H2,1-2H3,(H,31,33) |
| InChIKey | WKOCAIUYQLSWAN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|