C28H26ClN3O4S — CID 83275175
2-chloro-N-[3-[4-(4-methoxyanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83275175) has the molecular formula C28H26ClN3O4S and a molecular weight of 536.05 g/mol. Its IUPAC name is 2-chloro-N-[3-[4-(4-methoxyanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[4-(4-methoxyanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83275175 |
| Molecular Formula | C28H26ClN3O4S |
| Molecular Weight | 536.05 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | 2-chloro-N-[3-[4-(4-methoxyanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | COc1ccc(NC2=C(Sc3cccc(NC(=O)c4ccccc4Cl)c3)C(=O)N(CC(C)C)C2=O)cc1 |
| InChI | InChI=1S/C28H26ClN3O4S/c1-17(2)16-32-27(34)24(30-18-11-13-20(36-3)14-12-18)25(28(32)35)37-21-8-6-7-19(15-21)31-26(33)22-9-4-5-10-23(22)29/h4-15,17,30H,16H2,1-3H3,(H,31,33) |
| InChIKey | SVSSWTVUTTZWGG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.05 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|