C29H28ClN3O4S — CID 83276896
2-chloro-N-[3-[4-(3,4-dimethylanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83276896) has the molecular formula C29H28ClN3O4S and a molecular weight of 550.08 g/mol. Its IUPAC name is 2-chloro-N-[3-[4-(3,4-dimethylanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[4-(3,4-dimethylanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83276896 |
| Molecular Formula | C29H28ClN3O4S |
| Molecular Weight | 550.08 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | 2-chloro-N-[3-[4-(3,4-dimethylanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | COCCCN1C(=O)C(Nc2ccc(C)c(C)c2)=C(Sc2cccc(NC(=O)c3ccccc3Cl)c2)C1=O |
| InChI | InChI=1S/C29H28ClN3O4S/c1-18-12-13-21(16-19(18)2)31-25-26(29(36)33(28(25)35)14-7-15-37-3)38-22-9-6-8-20(17-22)32-27(34)23-10-4-5-11-24(23)30/h4-6,8-13,16-17,31H,7,14-15H2,1-3H3,(H,32,34) |
| InChIKey | GPKAHCRDIOOYGY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.08 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|