C30H31N3O6S — CID 83277407
N-[3-[4-(2,4-dimethoxyanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-methylbenzamide (PubChem CID 83277407) has the molecular formula C30H31N3O6S and a molecular weight of 561.66 g/mol. Its IUPAC name is N-[3-[4-(2,4-dimethoxyanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-methylbenzamide.
| Compound Name | N-[3-[4-(2,4-dimethoxyanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 83277407 |
| Molecular Formula | C30H31N3O6S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | N-[3-[4-(2,4-dimethoxyanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-methylbenzamide |
| SMILES | COCCCN1C(=O)C(Nc2ccc(OC)cc2OC)=C(Sc2cccc(NC(=O)c3ccc(C)cc3)c2)C1=O |
| InChI | InChI=1S/C30H31N3O6S/c1-19-9-11-20(12-10-19)28(34)31-21-7-5-8-23(17-21)40-27-26(29(35)33(30(27)36)15-6-16-37-2)32-24-14-13-22(38-3)18-25(24)39-4/h5,7-14,17-18,32H,6,15-16H2,1-4H3,(H,31,34) |
| InChIKey | BOQAADABIMIUAW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|