C29H26F3N3O4S — CID 83275169
N-[3-[4-(4-methoxyanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-(trifluoromethyl)benzamide (PubChem CID 83275169) has the molecular formula C29H26F3N3O4S and a molecular weight of 569.61 g/mol. Its IUPAC name is N-[3-[4-(4-methoxyanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[4-(4-methoxyanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 83275169 |
| Molecular Formula | C29H26F3N3O4S |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | N-[3-[4-(4-methoxyanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-(trifluoromethyl)benzamide |
| SMILES | COc1ccc(NC2=C(Sc3cccc(NC(=O)c4ccc(C(F)(F)F)cc4)c3)C(=O)N(CC(C)C)C2=O)cc1 |
| InChI | InChI=1S/C29H26F3N3O4S/c1-17(2)16-35-27(37)24(33-20-11-13-22(39-3)14-12-20)25(28(35)38)40-23-6-4-5-21(15-23)34-26(36)18-7-9-19(10-8-18)29(30,31)32/h4-15,17,33H,16H2,1-3H3,(H,34,36) |
| InChIKey | HAFDNWZDWOYGKU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|