C29H20F3N3O5S — CID 71957249
N-[3-[4-(4-methoxyanilino)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide (PubChem CID 71957249) has the molecular formula C29H20F3N3O5S and a molecular weight of 579.56 g/mol. Its IUPAC name is N-[3-[4-(4-methoxyanilino)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[4-(4-methoxyanilino)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 71957249 |
| Molecular Formula | C29H20F3N3O5S |
| Molecular Weight | 579.56 g/mol |
| Exact Mass | 579.11 |
| IUPAC Name | N-[3-[4-(4-methoxyanilino)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide |
| SMILES | COc1ccc(NC2=C(Sc3cccc(NC(=O)c4ccco4)c3)C(=O)N(c3ccc(C(F)(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C29H20F3N3O5S/c1-39-21-13-9-18(10-14-21)33-24-25(28(38)35(27(24)37)20-11-7-17(8-12-20)29(30,31)32)41-22-5-2-4-19(16-22)34-26(36)23-6-3-15-40-23/h2-16,33H,1H3,(H,34,36) |
| InChIKey | RXPTWTKXLZYQSP-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|