C29H23N3O4S — CID 83277209
N-[4-[4-anilino-1-(3,4-dimethylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide (PubChem CID 83277209) has the molecular formula C29H23N3O4S and a molecular weight of 509.59 g/mol. Its IUPAC name is N-[4-[4-anilino-1-(3,4-dimethylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide.
| Compound Name | N-[4-[4-anilino-1-(3,4-dimethylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 83277209 |
| Molecular Formula | C29H23N3O4S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | N-[4-[4-anilino-1-(3,4-dimethylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(N2C(=O)C(Nc3ccccc3)=C(Sc3ccc(NC(=O)c4ccco4)cc3)C2=O)cc1C |
| InChI | InChI=1S/C29H23N3O4S/c1-18-10-13-22(17-19(18)2)32-28(34)25(30-20-7-4-3-5-8-20)26(29(32)35)37-23-14-11-21(12-15-23)31-27(33)24-9-6-16-36-24/h3-17,30H,1-2H3,(H,31,33) |
| InChIKey | PFKSHVAVVDBBOP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|