C27H21N3O5S — CID 83277883
N-[4-[1-(furan-2-ylmethyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide (PubChem CID 83277883) has the molecular formula C27H21N3O5S and a molecular weight of 499.55 g/mol. Its IUPAC name is N-[4-[1-(furan-2-ylmethyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide.
| Compound Name | N-[4-[1-(furan-2-ylmethyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 83277883 |
| Molecular Formula | C27H21N3O5S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | N-[4-[1-(furan-2-ylmethyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC2=C(Sc3ccc(NC(=O)c4ccco4)cc3)C(=O)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C27H21N3O5S/c1-17-6-8-18(9-7-17)28-23-24(27(33)30(26(23)32)16-20-4-2-14-34-20)36-21-12-10-19(11-13-21)29-25(31)22-5-3-15-35-22/h2-15,28H,16H2,1H3,(H,29,31) |
| InChIKey | DXUQMYJEVKGRQX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|