C28H19BrFN3O4S — CID 83278968
N-[4-[4-(4-bromoanilino)-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-fluorobenzamide (PubChem CID 83278968) has the molecular formula C28H19BrFN3O4S and a molecular weight of 592.45 g/mol. Its IUPAC name is N-[4-[4-(4-bromoanilino)-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-fluorobenzamide.
| Compound Name | N-[4-[4-(4-bromoanilino)-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 83278968 |
| Molecular Formula | C28H19BrFN3O4S |
| Molecular Weight | 592.45 g/mol |
| Exact Mass | 591.03 |
| IUPAC Name | N-[4-[4-(4-bromoanilino)-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc(SC2=C(Nc3ccc(Br)cc3)C(=O)N(Cc3ccco3)C2=O)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H19BrFN3O4S/c29-18-5-9-20(10-6-18)31-24-25(28(36)33(27(24)35)16-22-2-1-15-37-22)38-23-13-11-21(12-14-23)32-26(34)17-3-7-19(30)8-4-17/h1-15,31H,16H2,(H,32,34) |
| InChIKey | SXJKWBXZVYWZMT-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.45 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|