C28H21N3O4S — CID 83279009
N-[4-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83279009) has the molecular formula C28H21N3O4S and a molecular weight of 495.56 g/mol. Its IUPAC name is N-[4-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | N-[4-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83279009 |
| Molecular Formula | C28H21N3O4S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | N-[4-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | O=C(Nc1ccc(SC2=C(Nc3ccccc3)C(=O)N(Cc3ccco3)C2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H21N3O4S/c32-26(19-8-3-1-4-9-19)30-21-13-15-23(16-14-21)36-25-24(29-20-10-5-2-6-11-20)27(33)31(28(25)34)18-22-12-7-17-35-22/h1-17,29H,18H2,(H,30,32) |
| InChIKey | JGWPNTCOIUOKQD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|