C29H23N3O5S — CID 83275423
N-[3-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-3-methoxybenzamide (PubChem CID 83275423) has the molecular formula C29H23N3O5S and a molecular weight of 525.59 g/mol. Its IUPAC name is N-[3-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-3-methoxybenzamide.
| Compound Name | N-[3-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 83275423 |
| Molecular Formula | C29H23N3O5S |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | N-[3-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2cccc(SC3=C(Nc4ccccc4)C(=O)N(Cc4ccco4)C3=O)c2)c1 |
| InChI | InChI=1S/C29H23N3O5S/c1-36-22-12-5-8-19(16-22)27(33)31-21-11-6-14-24(17-21)38-26-25(30-20-9-3-2-4-10-20)28(34)32(29(26)35)18-23-13-7-15-37-23/h2-17,30H,18H2,1H3,(H,31,33) |
| InChIKey | RRFRVVLEYPHQFY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|