C28H20N4O6S — CID 83279146
N-[3-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 83279146) has the molecular formula C28H20N4O6S and a molecular weight of 540.56 g/mol. Its IUPAC name is N-[3-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 83279146 |
| Molecular Formula | C28H20N4O6S |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | N-[3-[4-anilino-1-(furan-2-ylmethyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | O=C(Nc1cccc(SC2=C(Nc3ccccc3)C(=O)N(Cc3ccco3)C2=O)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H20N4O6S/c33-26(18-11-13-21(14-12-18)32(36)37)30-20-8-4-10-23(16-20)39-25-24(29-19-6-2-1-3-7-19)27(34)31(28(25)35)17-22-9-5-15-38-22/h1-16,29H,17H2,(H,30,33) |
| InChIKey | VIHAIOFQEIMSFW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|