C30H30N4O6S — CID 83274363
N-[3-[1-(3-methoxypropyl)-2,5-dioxo-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 83274363) has the molecular formula C30H30N4O6S and a molecular weight of 574.66 g/mol. Its IUPAC name is N-[3-[1-(3-methoxypropyl)-2,5-dioxo-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[1-(3-methoxypropyl)-2,5-dioxo-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 83274363 |
| Molecular Formula | C30H30N4O6S |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | N-[3-[1-(3-methoxypropyl)-2,5-dioxo-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | COCCCN1C(=O)C(Nc2ccc(C(C)C)cc2)=C(Sc2cccc(NC(=O)c3ccc([N+](=O)[O-])cc3)c2)C1=O |
| InChI | InChI=1S/C30H30N4O6S/c1-19(2)20-8-12-22(13-9-20)31-26-27(30(37)33(29(26)36)16-5-17-40-3)41-25-7-4-6-23(18-25)32-28(35)21-10-14-24(15-11-21)34(38)39/h4,6-15,18-19,31H,5,16-17H2,1-3H3,(H,32,35) |
| InChIKey | IOVBXMNBJLUZFP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|