C30H30FN3O4S — CID 83274319
4-fluoro-N-[4-[1-(3-methoxypropyl)-2,5-dioxo-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83274319) has the molecular formula C30H30FN3O4S and a molecular weight of 547.65 g/mol. Its IUPAC name is 4-fluoro-N-[4-[1-(3-methoxypropyl)-2,5-dioxo-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 4-fluoro-N-[4-[1-(3-methoxypropyl)-2,5-dioxo-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83274319 |
| Molecular Formula | C30H30FN3O4S |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 4-fluoro-N-[4-[1-(3-methoxypropyl)-2,5-dioxo-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | COCCCN1C(=O)C(Nc2ccc(C(C)C)cc2)=C(Sc2ccc(NC(=O)c3ccc(F)cc3)cc2)C1=O |
| InChI | InChI=1S/C30H30FN3O4S/c1-19(2)20-7-11-23(12-8-20)32-26-27(30(37)34(29(26)36)17-4-18-38-3)39-25-15-13-24(14-16-25)33-28(35)21-5-9-22(31)10-6-21/h5-16,19,32H,4,17-18H2,1-3H3,(H,33,35) |
| InChIKey | UFIAJLVTXJZIMG-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|