C29H29N3O4S — CID 83274255
N-[3-[1-(3-methoxypropyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-methylbenzamide (PubChem CID 83274255) has the molecular formula C29H29N3O4S and a molecular weight of 515.64 g/mol. Its IUPAC name is N-[3-[1-(3-methoxypropyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-methylbenzamide.
| Compound Name | N-[3-[1-(3-methoxypropyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 83274255 |
| Molecular Formula | C29H29N3O4S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | N-[3-[1-(3-methoxypropyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-methylbenzamide |
| SMILES | COCCCN1C(=O)C(Nc2ccc(C)cc2)=C(Sc2cccc(NC(=O)c3ccc(C)cc3)c2)C1=O |
| InChI | InChI=1S/C29H29N3O4S/c1-19-8-12-21(13-9-19)27(33)31-23-6-4-7-24(18-23)37-26-25(30-22-14-10-20(2)11-15-22)28(34)32(29(26)35)16-5-17-36-3/h4,6-15,18,30H,5,16-17H2,1-3H3,(H,31,33) |
| InChIKey | LSYJCOWFQPNJBS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|