C27H26BrN3O5S2 — CID 83277277
N-[3-[4-(4-bromoanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-methylbenzenesulfonamide (PubChem CID 83277277) has the molecular formula C27H26BrN3O5S2 and a molecular weight of 616.56 g/mol. Its IUPAC name is N-[3-[4-(4-bromoanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-[4-(4-bromoanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 83277277 |
| Molecular Formula | C27H26BrN3O5S2 |
| Molecular Weight | 616.56 g/mol |
| Exact Mass | 615.05 |
| IUPAC Name | N-[3-[4-(4-bromoanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-methylbenzenesulfonamide |
| SMILES | COCCCN1C(=O)C(Nc2ccc(Br)cc2)=C(Sc2cccc(NS(=O)(=O)c3ccc(C)cc3)c2)C1=O |
| InChI | InChI=1S/C27H26BrN3O5S2/c1-18-7-13-23(14-8-18)38(34,35)30-21-5-3-6-22(17-21)37-25-24(29-20-11-9-19(28)10-12-20)26(32)31(27(25)33)15-4-16-36-2/h3,5-14,17,29-30H,4,15-16H2,1-2H3 |
| InChIKey | KHGGTXFYGPSTIT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|