C28H29N3O7S2 — CID 83274281
N-[3-[4-(2,4-dimethoxyanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzenesulfonamide (PubChem CID 83274281) has the molecular formula C28H29N3O7S2 and a molecular weight of 583.69 g/mol. Its IUPAC name is N-[3-[4-(2,4-dimethoxyanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzenesulfonamide.
| Compound Name | N-[3-[4-(2,4-dimethoxyanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 83274281 |
| Molecular Formula | C28H29N3O7S2 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.14 |
| IUPAC Name | N-[3-[4-(2,4-dimethoxyanilino)-1-(3-methoxypropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzenesulfonamide |
| SMILES | COCCCN1C(=O)C(Nc2ccc(OC)cc2OC)=C(Sc2cccc(NS(=O)(=O)c3ccccc3)c2)C1=O |
| InChI | InChI=1S/C28H29N3O7S2/c1-36-16-8-15-31-27(32)25(29-23-14-13-20(37-2)18-24(23)38-3)26(28(31)33)39-21-10-7-9-19(17-21)30-40(34,35)22-11-5-4-6-12-22/h4-7,9-14,17-18,29-30H,8,15-16H2,1-3H3 |
| InChIKey | UXYQOBTUARSEON-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|