C32H35N3O4S — CID 83277714
4-tert-butyl-N-[3-[1-(3-methoxypropyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83277714) has the molecular formula C32H35N3O4S and a molecular weight of 557.72 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[1-(3-methoxypropyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[1-(3-methoxypropyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83277714 |
| Molecular Formula | C32H35N3O4S |
| Molecular Weight | 557.72 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | 4-tert-butyl-N-[3-[1-(3-methoxypropyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | COCCCN1C(=O)C(Nc2ccc(C)cc2)=C(Sc2cccc(NC(=O)c3ccc(C(C)(C)C)cc3)c2)C1=O |
| InChI | InChI=1S/C32H35N3O4S/c1-21-10-16-24(17-11-21)33-27-28(31(38)35(30(27)37)18-7-19-39-5)40-26-9-6-8-25(20-26)34-29(36)22-12-14-23(15-13-22)32(2,3)4/h6,8-17,20,33H,7,18-19H2,1-5H3,(H,34,36) |
| InChIKey | REMGXNNRZDJQCQ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.72 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|