C29H22FN3O4S — CID 83277708
4-fluoro-N-[3-[1-(furan-2-ylmethyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83277708) has the molecular formula C29H22FN3O4S and a molecular weight of 527.58 g/mol. Its IUPAC name is 4-fluoro-N-[3-[1-(furan-2-ylmethyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 4-fluoro-N-[3-[1-(furan-2-ylmethyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83277708 |
| Molecular Formula | C29H22FN3O4S |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 4-fluoro-N-[3-[1-(furan-2-ylmethyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | Cc1ccc(NC2=C(Sc3cccc(NC(=O)c4ccc(F)cc4)c3)C(=O)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C29H22FN3O4S/c1-18-7-13-21(14-8-18)31-25-26(29(36)33(28(25)35)17-23-5-3-15-37-23)38-24-6-2-4-22(16-24)32-27(34)19-9-11-20(30)12-10-19/h2-16,31H,17H2,1H3,(H,32,34) |
| InChIKey | QNIKZUAHJBVZQD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|