C29H22N4O6S — CID 91635167
N-[3-[1-(furan-2-ylmethyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 91635167) has the molecular formula C29H22N4O6S and a molecular weight of 554.58 g/mol. Its IUPAC name is N-[3-[1-(furan-2-ylmethyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[1-(furan-2-ylmethyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 91635167 |
| Molecular Formula | C29H22N4O6S |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | N-[3-[1-(furan-2-ylmethyl)-4-(4-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | Cc1ccc(NC2=C(Sc3cccc(NC(=O)c4ccc([N+](=O)[O-])cc4)c3)C(=O)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C29H22N4O6S/c1-18-7-11-20(12-8-18)30-25-26(29(36)32(28(25)35)17-23-5-3-15-39-23)40-24-6-2-4-21(16-24)31-27(34)19-9-13-22(14-10-19)33(37)38/h2-16,30H,17H2,1H3,(H,31,34) |
| InChIKey | DWURFMFJYCMTMX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|