C30H24N4O7S — CID 83276041
N-[3-[1-(furan-2-ylmethyl)-4-(2-methoxy-5-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 83276041) has the molecular formula C30H24N4O7S and a molecular weight of 584.61 g/mol. Its IUPAC name is N-[3-[1-(furan-2-ylmethyl)-4-(2-methoxy-5-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[1-(furan-2-ylmethyl)-4-(2-methoxy-5-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 83276041 |
| Molecular Formula | C30H24N4O7S |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | N-[3-[1-(furan-2-ylmethyl)-4-(2-methoxy-5-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | COc1ccc(C)cc1NC1=C(Sc2cccc(NC(=O)c3ccc([N+](=O)[O-])cc3)c2)C(=O)N(Cc2ccco2)C1=O |
| InChI | InChI=1S/C30H24N4O7S/c1-18-8-13-25(40-2)24(15-18)32-26-27(30(37)33(29(26)36)17-22-6-4-14-41-22)42-23-7-3-5-20(16-23)31-28(35)19-9-11-21(12-10-19)34(38)39/h3-16,32H,17H2,1-2H3,(H,31,35) |
| InChIKey | PKTZIFKAFCNMLD-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 144.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|